C8H11N3 — CID 168957890
3-methyl-7-methylidene-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 168957890) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 3-methyl-7-methylidene-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-methyl-7-methylidene-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 168957890 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 3-methyl-7-methylidene-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | C=C1CCn2c(C)nnc2C1 |
| InChI | InChI=1S/C8H11N3/c1-6-3-4-11-7(2)9-10-8(11)5-6/h1,3-5H2,2H3 |
| InChIKey | MOUHQEFUNPXDES-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|