C28H25N3O2 — CID 168957958
[4-(9-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]-(1H-pyrrolo[3,2-c]pyridin-7-yl)methanone (PubChem CID 168957958) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is [4-(9-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]-(1H-pyrrolo[3,2-c]pyridin-7-yl)methanone.
| Compound Name | [4-(9-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]-(1H-pyrrolo[3,2-c]pyridin-7-yl)methanone |
|---|---|
| PubChem CID | 168957958 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | [4-(9-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]-(1H-pyrrolo[3,2-c]pyridin-7-yl)methanone |
| SMILES | O=C(c1cncc2cc[nH]c12)N1CCC(=C2c3ccccc3CC(O)c3ccccc32)CC1 |
| InChI | InChI=1S/C28H25N3O2/c32-25-15-19-5-1-2-6-21(19)26(23-8-4-3-7-22(23)25)18-10-13-31(14-11-18)28(33)24-17-29-16-20-9-12-30-27(20)24/h1-9,12,16-17,25,30,32H,10-11,13-15H2 |
| InChIKey | GOGOOBIKTUBBMN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|