C21H28FN6O2+ — CID 168958256
amino-cyclopropyl-[(2-fluoro-5-methylphenyl)methylcarbamoyl]-[(3R)-1-(6-oxo-1H-pyrimidin-2-yl)piperidin-3-yl]azanium (PubChem CID 168958256) has the molecular formula C21H28FN6O2+ and a molecular weight of 415.49 g/mol. Its IUPAC name is amino-cyclopropyl-[(2-fluoro-5-methylphenyl)methylcarbamoyl]-[(3R)-1-(6-oxo-1H-pyrimidin-2-yl)piperidin-3-yl]azanium.
| Compound Name | amino-cyclopropyl-[(2-fluoro-5-methylphenyl)methylcarbamoyl]-[(3R)-1-(6-oxo-1H-pyrimidin-2-yl)piperidin-3-yl]azanium |
|---|---|
| PubChem CID | 168958256 |
| Molecular Formula | C21H28FN6O2+ |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | amino-cyclopropyl-[(2-fluoro-5-methylphenyl)methylcarbamoyl]-[(3R)-1-(6-oxo-1H-pyrimidin-2-yl)piperidin-3-yl]azanium |
| SMILES | Cc1ccc(F)c(CNC(=O)[N+](N)(C2CC2)[C@@H]2CCCN(c3nccc(=O)[nH]3)C2)c1 |
| InChI | InChI=1S/C21H27FN6O2/c1-14-4-7-18(22)15(11-14)12-25-21(30)28(23,16-5-6-16)17-3-2-10-27(13-17)20-24-9-8-19(29)26-20/h4,7-9,11,16-17H,2-3,5-6,10,12-13,23H2,1H3,(H-,24,25,26,29,30)/p+1/t17-,28?/m1/s1 |
| InChIKey | RWNKTDSYMLOJSM-WPUOIDIFSA-O |
| XLogP | 1.95 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|