C28H42N10O2S — CID 168958625
N-[3-[4-[[amino-[5-amino-6-(2-aminoethylamino)-2-propylsulfanylpyrimidin-4-yl]amino]methyl]phenyl]prop-2-ynyl]-1-(2-formamidoethyl)piperidine-4-carboxamide (PubChem CID 168958625) has the molecular formula C28H42N10O2S and a molecular weight of 582.78 g/mol. Its IUPAC name is N-[3-[4-[[amino-[5-amino-6-(2-aminoethylamino)-2-propylsulfanylpyrimidin-4-yl]amino]methyl]phenyl]prop-2-ynyl]-1-(2-formamidoethyl)piperidine-4-carboxamide.
| Compound Name | N-[3-[4-[[amino-[5-amino-6-(2-aminoethylamino)-2-propylsulfanylpyrimidin-4-yl]amino]methyl]phenyl]prop-2-ynyl]-1-(2-formamidoethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 168958625 |
| Molecular Formula | C28H42N10O2S |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | N-[3-[4-[[amino-[5-amino-6-(2-aminoethylamino)-2-propylsulfanylpyrimidin-4-yl]amino]methyl]phenyl]prop-2-ynyl]-1-(2-formamidoethyl)piperidine-4-carboxamide |
| SMILES | CCCSc1nc(NCCN)c(N)c(N(N)Cc2ccc(C#CCNC(=O)C3CCN(CCNC=O)CC3)cc2)n1 |
| InChI | InChI=1S/C28H42N10O2S/c1-2-18-41-28-35-25(33-13-11-29)24(30)26(36-28)38(31)19-22-7-5-21(6-8-22)4-3-12-34-27(40)23-9-15-37(16-10-23)17-14-32-20-39/h5-8,20,23H,2,9-19,29-31H2,1H3,(H,32,39)(H,34,40)(H,33,35,36) |
| InChIKey | KJUZVCFABAGIDV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 180.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|