About 4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide
4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide (PubChem CID 168959505) has the molecular formula C16H33NO2
and a molecular weight of 271.44 g/mol. Its IUPAC name is 4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide.
Molecular Properties
| Compound Name | 4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide |
| PubChem CID | 168959505 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide |
| SMILES | CCCC(C)(CC)CNC(=O)C(C)(C)CCOCC |
| InChI | InChI=1S/C16H33NO2/c1-7-10-16(6,8-2)13-17-14(18)15(4,5)11-12-19-9-3/h7-13H2,1-6H3,(H,17,18) |
| InChIKey | QCVOXGLXAWIYMJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide?
The IUPAC name of 4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide (CID 168959505) is 4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide.
What is the SMILES notation for 4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide?
The canonical SMILES for 4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide is CCCC(C)(CC)CNC(=O)C(C)(C)CCOCC.
What is the InChIKey of 4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide?
The InChIKey is QCVOXGLXAWIYMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO2/c1-7-10-16(6,8-2)13-17-14(18)15(4,5)11-12-19-9-3/h7-13H2,1-6H3,(H,17,18).
What are the key properties of 4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide?
4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide has a molecular weight of 271.44 g/mol, XLogP of 3.77, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-N-(2-ethyl-2-methylpentyl)-2,2-dimethylbutanamide is sourced from PubChem (CID 168959505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).