C25H27F2N5O2S — CID 168959710
N-[(3R)-7-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5,6-difluoro-3,4-dihydro-2H-chromen-3-yl]-3-amino-6-methylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 168959710) has the molecular formula C25H27F2N5O2S and a molecular weight of 499.59 g/mol. Its IUPAC name is N-[(3R)-7-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5,6-difluoro-3,4-dihydro-2H-chromen-3-yl]-3-amino-6-methylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-[(3R)-7-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5,6-difluoro-3,4-dihydro-2H-chromen-3-yl]-3-amino-6-methylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 168959710 |
| Molecular Formula | C25H27F2N5O2S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-[(3R)-7-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5,6-difluoro-3,4-dihydro-2H-chromen-3-yl]-3-amino-6-methylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccc2c(N)c(C(=O)N[C@H]3COc4cc(N5CCN6CCCC6C5)c(F)c(F)c4C3)sc2n1 |
| InChI | InChI=1S/C25H27F2N5O2S/c1-13-4-5-16-22(28)23(35-25(16)29-13)24(33)30-14-9-17-19(34-12-14)10-18(21(27)20(17)26)32-8-7-31-6-2-3-15(31)11-32/h4-5,10,14-15H,2-3,6-9,11-12,28H2,1H3,(H,30,33)/t14-,15?/m1/s1 |
| InChIKey | GIXODSMFIZIJKV-GICMACPYSA-N |
| XLogP | 3.48 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |