C50H76N2O6 — CID 168960174
bis[3-[2-[di(propan-2-yl)amino]ethyl]-1-benzofuran-4-yl] 2,2,4,4,7,7,9,9-octamethyldecanedioate (PubChem CID 168960174) has the molecular formula C50H76N2O6 and a molecular weight of 801.17 g/mol. Its IUPAC name is bis[3-[2-[di(propan-2-yl)amino]ethyl]-1-benzofuran-4-yl] 2,2,4,4,7,7,9,9-octamethyldecanedioate.
| Compound Name | bis[3-[2-[di(propan-2-yl)amino]ethyl]-1-benzofuran-4-yl] 2,2,4,4,7,7,9,9-octamethyldecanedioate |
|---|---|
| PubChem CID | 168960174 |
| Molecular Formula | C50H76N2O6 |
| Molecular Weight | 801.17 g/mol |
| Exact Mass | 800.57 |
| IUPAC Name | bis[3-[2-[di(propan-2-yl)amino]ethyl]-1-benzofuran-4-yl] 2,2,4,4,7,7,9,9-octamethyldecanedioate |
| SMILES | CC(C)N(CCc1coc2cccc(OC(=O)C(C)(C)CC(C)(C)CCC(C)(C)CC(C)(C)C(=O)Oc3cccc4occ(CCN(C(C)C)C(C)C)c34)c12)C(C)C |
| InChI | InChI=1S/C50H76N2O6/c1-33(2)51(34(3)4)27-23-37-29-55-39-19-17-21-41(43(37)39)57-45(53)49(13,14)31-47(9,10)25-26-48(11,12)32-50(15,16)46(54)58-42-22-18-20-40-44(42)38(30-56-40)24-28-52(35(5)6)36(7)8/h17-22,29-30,33-36H,23-28,31-32H2,1-16H3 |
| InChIKey | GRKKMDRVRYERTD-UHFFFAOYSA-N |
| XLogP | 12.68 |
| TPSA | 85.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.17 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|