About 2,4-dichlorobenzotriazole
2,4-dichlorobenzotriazole (PubChem CID 168960354) has the molecular formula C6H3Cl2N3
and a molecular weight of 188.02 g/mol. Its IUPAC name is 2,4-dichlorobenzotriazole.
Molecular Properties
| Compound Name | 2,4-dichlorobenzotriazole |
| PubChem CID | 168960354 |
| Molecular Formula | C6H3Cl2N3 |
| Molecular Weight | 188.02 g/mol |
| Exact Mass | 186.97 |
| IUPAC Name | 2,4-dichlorobenzotriazole |
| SMILES | Clc1cccc2nn(Cl)nc12 |
| InChI | InChI=1S/C6H3Cl2N3/c7-4-2-1-3-5-6(4)10-11(8)9-5/h1-3H |
| InChIKey | VHOJFHZITIBVGM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.02 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dichlorobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichlorobenzotriazole?
The IUPAC name of 2,4-dichlorobenzotriazole (CID 168960354) is 2,4-dichlorobenzotriazole.
What is the SMILES notation for 2,4-dichlorobenzotriazole?
The canonical SMILES for 2,4-dichlorobenzotriazole is Clc1cccc2nn(Cl)nc12.
What is the InChIKey of 2,4-dichlorobenzotriazole?
The InChIKey is VHOJFHZITIBVGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2N3/c7-4-2-1-3-5-6(4)10-11(8)9-5/h1-3H.
What are the key properties of 2,4-dichlorobenzotriazole?
2,4-dichlorobenzotriazole has a molecular weight of 188.02 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichlorobenzotriazole is sourced from PubChem (CID 168960354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).