C21H27N3O4 — CID 168960686
3-[6-[[[(1R,2S)-2-methoxycyclohexyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168960686) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 3-[6-[[[(1R,2S)-2-methoxycyclohexyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[[(1R,2S)-2-methoxycyclohexyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168960686 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 3-[6-[[[(1R,2S)-2-methoxycyclohexyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CO[C@H]1CCCC[C@H]1NCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H27N3O4/c1-28-18-5-3-2-4-16(18)22-11-13-6-7-15-14(10-13)12-24(21(15)27)17-8-9-19(25)23-20(17)26/h6-7,10,16-18,22H,2-5,8-9,11-12H2,1H3,(H,23,25,26)/t16-,17?,18+/m1/s1 |
| InChIKey | WJVOVHQMGCBRBY-BLAYRMRBSA-N |
| XLogP | 1.49 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|