About 3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane
3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane (PubChem CID 168961102) has the molecular formula C12H18N2OS
and a molecular weight of 238.36 g/mol. Its IUPAC name is 3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane.
Molecular Properties
| Compound Name | 3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane |
| PubChem CID | 168961102 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane |
| SMILES | CC.Cc1csc(C(=O)N2CC3CC3C2)n1 |
| InChI | InChI=1S/C10H12N2OS.C2H6/c1-6-5-14-9(11-6)10(13)12-3-7-2-8(7)4-12;1-2/h5,7-8H,2-4H2,1H3;1-2H3 |
| InChIKey | LUCVLRZYWFSYSG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane?
The IUPAC name of 3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane (CID 168961102) is 3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane.
What is the SMILES notation for 3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane?
The canonical SMILES for 3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane is CC.Cc1csc(C(=O)N2CC3CC3C2)n1.
What is the InChIKey of 3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane?
The InChIKey is LUCVLRZYWFSYSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2OS.C2H6/c1-6-5-14-9(11-6)10(13)12-3-7-2-8(7)4-12;1-2/h5,7-8H,2-4H2,1H3;1-2H3.
What are the key properties of 3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane?
3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane has a molecular weight of 238.36 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azabicyclo[3.1.0]hexan-3-yl-(4-methyl-1,3-thiazol-2-yl)methanone;ethane is sourced from PubChem (CID 168961102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).