C27H22FN3O2 — CID 168961215
(1R,5R,6R)-3-benzoyl-1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-3-azabicyclo[3.1.0]hexane-6-carbaldehyde (PubChem CID 168961215) has the molecular formula C27H22FN3O2 and a molecular weight of 439.49 g/mol. Its IUPAC name is (1R,5R,6R)-3-benzoyl-1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-3-azabicyclo[3.1.0]hexane-6-carbaldehyde.
| Compound Name | (1R,5R,6R)-3-benzoyl-1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-3-azabicyclo[3.1.0]hexane-6-carbaldehyde |
|---|---|
| PubChem CID | 168961215 |
| Molecular Formula | C27H22FN3O2 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (1R,5R,6R)-3-benzoyl-1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-3-azabicyclo[3.1.0]hexane-6-carbaldehyde |
| SMILES | Cc1cc2c(cnn2-c2ccc(F)cc2)cc1[C@@]12CN(C(=O)c3ccccc3)C[C@@H]1[C@H]2C=O |
| InChI | InChI=1S/C27H22FN3O2/c1-17-11-25-19(13-29-31(25)21-9-7-20(28)8-10-21)12-22(17)27-16-30(14-23(27)24(27)15-32)26(33)18-5-3-2-4-6-18/h2-13,15,23-24H,14,16H2,1H3/t23-,24-,27+/m1/s1 |
| InChIKey | IZZFRAZYLXGPCT-OASJLCFRSA-N |
| XLogP | 4.31 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|