C18H30O — CID 168962516
(3Z,5Z)-1-(4-butylcyclohexyl)octa-3,5-dien-1-one (PubChem CID 168962516) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is (3Z,5Z)-1-(4-butylcyclohexyl)octa-3,5-dien-1-one.
| Compound Name | (3Z,5Z)-1-(4-butylcyclohexyl)octa-3,5-dien-1-one |
|---|---|
| PubChem CID | 168962516 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | (3Z,5Z)-1-(4-butylcyclohexyl)octa-3,5-dien-1-one |
| SMILES | CC/C=C\C=C/CC(=O)C1CCC(CCCC)CC1 |
| InChI | InChI=1S/C18H30O/c1-3-5-7-8-9-11-18(19)17-14-12-16(13-15-17)10-6-4-2/h5,7-9,16-17H,3-4,6,10-15H2,1-2H3/b7-5-,9-8- |
| InChIKey | DDXQXCXICXZHPX-PJHABFGRSA-N |
| XLogP | 5.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|