C28H33N7O2 — CID 168962638
8-[cyclohexyl(methyl)amino]-5-methyl-6-oxo-1,5-naphthyridine-2,7-dicarbonitrile;(E)-N-[(2-methylpropan-2-yl)oxy]-1-pyridin-2-ylmethanimine (PubChem CID 168962638) has the molecular formula C28H33N7O2 and a molecular weight of 499.62 g/mol. Its IUPAC name is 8-[cyclohexyl(methyl)amino]-5-methyl-6-oxo-1,5-naphthyridine-2,7-dicarbonitrile;(E)-N-[(2-methylpropan-2-yl)oxy]-1-pyridin-2-ylmethanimine.
| Compound Name | 8-[cyclohexyl(methyl)amino]-5-methyl-6-oxo-1,5-naphthyridine-2,7-dicarbonitrile;(E)-N-[(2-methylpropan-2-yl)oxy]-1-pyridin-2-ylmethanimine |
|---|---|
| PubChem CID | 168962638 |
| Molecular Formula | C28H33N7O2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 8-[cyclohexyl(methyl)amino]-5-methyl-6-oxo-1,5-naphthyridine-2,7-dicarbonitrile;(E)-N-[(2-methylpropan-2-yl)oxy]-1-pyridin-2-ylmethanimine |
| SMILES | CC(C)(C)O/N=C/c1ccccn1.CN(c1c(C#N)c(=O)n(C)c2ccc(C#N)nc12)C1CCCCC1 |
| InChI | InChI=1S/C18H19N5O.C10H14N2O/c1-22(13-6-4-3-5-7-13)17-14(11-20)18(24)23(2)15-9-8-12(10-19)21-16(15)17;1-10(2,3)13-12-8-9-6-4-5-7-11-9/h8-9,13H,3-7H2,1-2H3;4-8H,1-3H3/b;12-8+ |
| InChIKey | BWYSRYINCZUGIB-AMEPUADKSA-N |
| XLogP | 4.68 |
| TPSA | 120.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|