C30H41ClN4O5 — CID 168962906
4-chloro-2-[4-[N-[[(2R)-1,4-dioxan-2-yl]methyl]-4-methoxyanilino]cyclohexyl]-5-[[(1R,5R,6S,7R)-7-methyl-3-oxabicyclo[4.1.0]heptan-5-yl]methylamino]pyridazin-3-one (PubChem CID 168962906) has the molecular formula C30H41ClN4O5 and a molecular weight of 573.13 g/mol. Its IUPAC name is 4-chloro-2-[4-[N-[[(2R)-1,4-dioxan-2-yl]methyl]-4-methoxyanilino]cyclohexyl]-5-[[(1R,5R,6S,7R)-7-methyl-3-oxabicyclo[4.1.0]heptan-5-yl]methylamino]pyridazin-3-one.
| Compound Name | 4-chloro-2-[4-[N-[[(2R)-1,4-dioxan-2-yl]methyl]-4-methoxyanilino]cyclohexyl]-5-[[(1R,5R,6S,7R)-7-methyl-3-oxabicyclo[4.1.0]heptan-5-yl]methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 168962906 |
| Molecular Formula | C30H41ClN4O5 |
| Molecular Weight | 573.13 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | 4-chloro-2-[4-[N-[[(2R)-1,4-dioxan-2-yl]methyl]-4-methoxyanilino]cyclohexyl]-5-[[(1R,5R,6S,7R)-7-methyl-3-oxabicyclo[4.1.0]heptan-5-yl]methylamino]pyridazin-3-one |
| SMILES | COc1ccc(N(C[C@@H]2COCCO2)C2CCC(n3ncc(NC[C@@H]4COC[C@@H]5[C@H](C)[C@H]45)c(Cl)c3=O)CC2)cc1 |
| InChI | InChI=1S/C30H41ClN4O5/c1-19-26-18-39-16-20(28(19)26)13-32-27-14-33-35(30(36)29(27)31)23-5-3-21(4-6-23)34(15-25-17-38-11-12-40-25)22-7-9-24(37-2)10-8-22/h7-10,14,19-21,23,25-26,28,32H,3-6,11-13,15-18H2,1-2H3/t19-,20+,21?,23?,25+,26+,28+/m0/s1 |
| InChIKey | JGKSONJSXBPQIC-MPTDWHBRSA-N |
| XLogP | 4.25 |
| TPSA | 87.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.13 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|