C10H8FN3O4S — CID 168962959
N-(4-cyano-2-fluorophenyl)-2-oxo-1,3-oxazolidine-3-sulfonamide (PubChem CID 168962959) has the molecular formula C10H8FN3O4S and a molecular weight of 285.26 g/mol. Its IUPAC name is N-(4-cyano-2-fluorophenyl)-2-oxo-1,3-oxazolidine-3-sulfonamide.
| Compound Name | N-(4-cyano-2-fluorophenyl)-2-oxo-1,3-oxazolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168962959 |
| Molecular Formula | C10H8FN3O4S |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | N-(4-cyano-2-fluorophenyl)-2-oxo-1,3-oxazolidine-3-sulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)N2CCOC2=O)c(F)c1 |
| InChI | InChI=1S/C10H8FN3O4S/c11-8-5-7(6-12)1-2-9(8)13-19(16,17)14-3-4-18-10(14)15/h1-2,5,13H,3-4H2 |
| InChIKey | ZSJWNHBGYCKUOP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |