About 4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane
4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane (PubChem CID 168963064) has the molecular formula C22H30ClN3O2
and a molecular weight of 403.95 g/mol. Its IUPAC name is 4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane.
Molecular Properties
| Compound Name | 4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane |
| PubChem CID | 168963064 |
| Molecular Formula | C22H30ClN3O2 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane |
| SMILES | C1CCOCC1.CNc1cnn(-c2ccc(C3CCCCC3)cc2)c(=O)c1Cl |
| InChI | InChI=1S/C17H20ClN3O.C5H10O/c1-19-15-11-20-21(17(22)16(15)18)14-9-7-13(8-10-14)12-5-3-2-4-6-12;1-2-4-6-5-3-1/h7-12,19H,2-6H2,1H3;1-5H2 |
| InChIKey | YDJFNBINAAEKTD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane?
The IUPAC name of 4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane (CID 168963064) is 4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane.
What is the SMILES notation for 4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane?
The canonical SMILES for 4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane is C1CCOCC1.CNc1cnn(-c2ccc(C3CCCCC3)cc2)c(=O)c1Cl.
What is the InChIKey of 4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane?
The InChIKey is YDJFNBINAAEKTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN3O.C5H10O/c1-19-15-11-20-21(17(22)16(15)18)14-9-7-13(8-10-14)12-5-3-2-4-6-12;1-2-4-6-5-3-1/h7-12,19H,2-6H2,1H3;1-5H2.
What are the key properties of 4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane?
4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane has a molecular weight of 403.95 g/mol, XLogP of 5.16, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(4-cyclohexylphenyl)-5-(methylamino)pyridazin-3-one;oxane is sourced from PubChem (CID 168963064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).