About 5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol
5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol (PubChem CID 168964486) has the molecular formula C14H12BrNO4
and a molecular weight of 338.16 g/mol. Its IUPAC name is 5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol.
Molecular Properties
| Compound Name | 5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol |
| PubChem CID | 168964486 |
| Molecular Formula | C14H12BrNO4 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol |
| SMILES | CN(c1ccc(Br)cc1)c1ccc2c(c1)OC(O)(O)O2 |
| InChI | InChI=1S/C14H12BrNO4/c1-16(10-4-2-9(15)3-5-10)11-6-7-12-13(8-11)20-14(17,18)19-12/h2-8,17-18H,1H3 |
| InChIKey | OWQIXOCNSZKHMS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol?
The IUPAC name of 5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol (CID 168964486) is 5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol.
What is the SMILES notation for 5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol?
The canonical SMILES for 5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol is CN(c1ccc(Br)cc1)c1ccc2c(c1)OC(O)(O)O2.
What is the InChIKey of 5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol?
The InChIKey is OWQIXOCNSZKHMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrNO4/c1-16(10-4-2-9(15)3-5-10)11-6-7-12-13(8-11)20-14(17,18)19-12/h2-8,17-18H,1H3.
What are the key properties of 5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol?
5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol has a molecular weight of 338.16 g/mol, XLogP of 2.58, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromo-N-methylanilino)-1,3-benzodioxole-2,2-diol is sourced from PubChem (CID 168964486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).