C18H18BF4N5 — CID 168965052
3-[4-(1-methylpyrazol-3-yl)-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-3-pyridinyl]borolane-1-carbonitrile (PubChem CID 168965052) has the molecular formula C18H18BF4N5 and a molecular weight of 391.18 g/mol. Its IUPAC name is 3-[4-(1-methylpyrazol-3-yl)-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-3-pyridinyl]borolane-1-carbonitrile.
| Compound Name | 3-[4-(1-methylpyrazol-3-yl)-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-3-pyridinyl]borolane-1-carbonitrile |
|---|---|
| PubChem CID | 168965052 |
| Molecular Formula | C18H18BF4N5 |
| Molecular Weight | 391.18 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 3-[4-(1-methylpyrazol-3-yl)-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-3-pyridinyl]borolane-1-carbonitrile |
| SMILES | Cn1ccc(-c2cc(N3CC(F)(F)C(F)(F)C3)ncc2C2CCB(C#N)C2)n1 |
| InChI | InChI=1S/C18H18BF4N5/c1-27-5-3-15(26-27)13-6-16(28-9-17(20,21)18(22,23)10-28)25-8-14(13)12-2-4-19(7-12)11-24/h3,5-6,8,12H,2,4,7,9-10H2,1H3 |
| InChIKey | RFSSPLBLDLTNOP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.18 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|