C24H15Cl2FN6O3 — CID 168966461
6-amino-2-[3,5-dichloro-4-[2-(6-fluoro-3-pyridinyl)-4-methylquinolin-6-yl]oxyphenyl]-1,2,4-triazine-3,5-dione (PubChem CID 168966461) has the molecular formula C24H15Cl2FN6O3 and a molecular weight of 525.33 g/mol. Its IUPAC name is 6-amino-2-[3,5-dichloro-4-[2-(6-fluoro-3-pyridinyl)-4-methylquinolin-6-yl]oxyphenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 6-amino-2-[3,5-dichloro-4-[2-(6-fluoro-3-pyridinyl)-4-methylquinolin-6-yl]oxyphenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 168966461 |
| Molecular Formula | C24H15Cl2FN6O3 |
| Molecular Weight | 525.33 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | 6-amino-2-[3,5-dichloro-4-[2-(6-fluoro-3-pyridinyl)-4-methylquinolin-6-yl]oxyphenyl]-1,2,4-triazine-3,5-dione |
| SMILES | Cc1cc(-c2ccc(F)nc2)nc2ccc(Oc3c(Cl)cc(-n4nc(N)c(=O)[nH]c4=O)cc3Cl)cc12 |
| InChI | InChI=1S/C24H15Cl2FN6O3/c1-11-6-19(12-2-5-20(27)29-10-12)30-18-4-3-14(9-15(11)18)36-21-16(25)7-13(8-17(21)26)33-24(35)31-23(34)22(28)32-33/h2-10H,1H3,(H2,28,32)(H,31,34,35) |
| InChIKey | MBBZQWYNAMWQRW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|