C25H14Cl4FN5O3 — CID 168966471
6-amino-2-[3,5-dichloro-4-[2-(3,5-dichloro-4-fluorophenyl)-4-methylquinolin-6-yl]oxyphenyl]-1,2,4-triazine-3,5-dione (PubChem CID 168966471) has the molecular formula C25H14Cl4FN5O3 and a molecular weight of 593.23 g/mol. Its IUPAC name is 6-amino-2-[3,5-dichloro-4-[2-(3,5-dichloro-4-fluorophenyl)-4-methylquinolin-6-yl]oxyphenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 6-amino-2-[3,5-dichloro-4-[2-(3,5-dichloro-4-fluorophenyl)-4-methylquinolin-6-yl]oxyphenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 168966471 |
| Molecular Formula | C25H14Cl4FN5O3 |
| Molecular Weight | 593.23 g/mol |
| Exact Mass | 590.98 |
| IUPAC Name | 6-amino-2-[3,5-dichloro-4-[2-(3,5-dichloro-4-fluorophenyl)-4-methylquinolin-6-yl]oxyphenyl]-1,2,4-triazine-3,5-dione |
| SMILES | Cc1cc(-c2cc(Cl)c(F)c(Cl)c2)nc2ccc(Oc3c(Cl)cc(-n4nc(N)c(=O)[nH]c4=O)cc3Cl)cc12 |
| InChI | InChI=1S/C25H14Cl4FN5O3/c1-10-4-20(11-5-15(26)21(30)16(27)6-11)32-19-3-2-13(9-14(10)19)38-22-17(28)7-12(8-18(22)29)35-25(37)33-24(36)23(31)34-35/h2-9H,1H3,(H2,31,34)(H,33,36,37) |
| InChIKey | CCTCCAGOYUIFNN-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.23 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|