C10H13NO — CID 168966556
(1R)-1-methyl-1,2,3,4-tetrahydroisoquinolin-4-ol (PubChem CID 168966556) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (1R)-1-methyl-1,2,3,4-tetrahydroisoquinolin-4-ol.
| Compound Name | (1R)-1-methyl-1,2,3,4-tetrahydroisoquinolin-4-ol |
|---|---|
| PubChem CID | 168966556 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (1R)-1-methyl-1,2,3,4-tetrahydroisoquinolin-4-ol |
| SMILES | C[C@H]1NCC(O)c2ccccc21 |
| InChI | InChI=1S/C10H13NO/c1-7-8-4-2-3-5-9(8)10(12)6-11-7/h2-5,7,10-12H,6H2,1H3/t7-,10?/m1/s1 |
| InChIKey | GQLDKRHWSODCHU-PVSHWOEXSA-N |
| XLogP | 1.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |