C26H18ClF3N4O2 — CID 168968091
5-[(but-2-ynoylamino)methyl]-2-chloro-N-[1-[4-(trifluoromethyl)phenyl]indazol-4-yl]benzamide (PubChem CID 168968091) has the molecular formula C26H18ClF3N4O2 and a molecular weight of 510.90 g/mol. Its IUPAC name is 5-[(but-2-ynoylamino)methyl]-2-chloro-N-[1-[4-(trifluoromethyl)phenyl]indazol-4-yl]benzamide.
| Compound Name | 5-[(but-2-ynoylamino)methyl]-2-chloro-N-[1-[4-(trifluoromethyl)phenyl]indazol-4-yl]benzamide |
|---|---|
| PubChem CID | 168968091 |
| Molecular Formula | C26H18ClF3N4O2 |
| Molecular Weight | 510.90 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 5-[(but-2-ynoylamino)methyl]-2-chloro-N-[1-[4-(trifluoromethyl)phenyl]indazol-4-yl]benzamide |
| SMILES | CC#CC(=O)NCc1ccc(Cl)c(C(=O)Nc2cccc3c2cnn3-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C26H18ClF3N4O2/c1-2-4-24(35)31-14-16-7-12-21(27)19(13-16)25(36)33-22-5-3-6-23-20(22)15-32-34(23)18-10-8-17(9-11-18)26(28,29)30/h3,5-13,15H,14H2,1H3,(H,31,35)(H,33,36) |
| InChIKey | NNUNOYFKQPUBFP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.90 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|