C28H25Cl2F3N4O3 — CID 168968204
2-chloro-3-[chloro-(2,2-dimethylpropanoylamino)methyl]-N-[1-[2-methyl-4-(trifluoromethoxy)phenyl]indazol-4-yl]benzamide (PubChem CID 168968204) has the molecular formula C28H25Cl2F3N4O3 and a molecular weight of 593.43 g/mol. Its IUPAC name is 2-chloro-3-[chloro-(2,2-dimethylpropanoylamino)methyl]-N-[1-[2-methyl-4-(trifluoromethoxy)phenyl]indazol-4-yl]benzamide.
| Compound Name | 2-chloro-3-[chloro-(2,2-dimethylpropanoylamino)methyl]-N-[1-[2-methyl-4-(trifluoromethoxy)phenyl]indazol-4-yl]benzamide |
|---|---|
| PubChem CID | 168968204 |
| Molecular Formula | C28H25Cl2F3N4O3 |
| Molecular Weight | 593.43 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | 2-chloro-3-[chloro-(2,2-dimethylpropanoylamino)methyl]-N-[1-[2-methyl-4-(trifluoromethoxy)phenyl]indazol-4-yl]benzamide |
| SMILES | Cc1cc(OC(F)(F)F)ccc1-n1ncc2c(NC(=O)c3cccc(C(Cl)NC(=O)C(C)(C)C)c3Cl)cccc21 |
| InChI | InChI=1S/C28H25Cl2F3N4O3/c1-15-13-16(40-28(31,32)33)11-12-21(15)37-22-10-6-9-20(19(22)14-34-37)35-25(38)18-8-5-7-17(23(18)29)24(30)36-26(39)27(2,3)4/h5-14,24H,1-4H3,(H,35,38)(H,36,39) |
| InChIKey | FRJUTXLYAIIRDR-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.43 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|