C30H33ClN4O2 — CID 168968291
2-chloro-5-[(2,2-dimethylpropanoylamino)methyl]-N-[1-(4-phenylbutyl)indazol-4-yl]benzamide (PubChem CID 168968291) has the molecular formula C30H33ClN4O2 and a molecular weight of 517.07 g/mol. Its IUPAC name is 2-chloro-5-[(2,2-dimethylpropanoylamino)methyl]-N-[1-(4-phenylbutyl)indazol-4-yl]benzamide.
| Compound Name | 2-chloro-5-[(2,2-dimethylpropanoylamino)methyl]-N-[1-(4-phenylbutyl)indazol-4-yl]benzamide |
|---|---|
| PubChem CID | 168968291 |
| Molecular Formula | C30H33ClN4O2 |
| Molecular Weight | 517.07 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 2-chloro-5-[(2,2-dimethylpropanoylamino)methyl]-N-[1-(4-phenylbutyl)indazol-4-yl]benzamide |
| SMILES | CC(C)(C)C(=O)NCc1ccc(Cl)c(C(=O)Nc2cccc3c2cnn3CCCCc2ccccc2)c1 |
| InChI | InChI=1S/C30H33ClN4O2/c1-30(2,3)29(37)32-19-22-15-16-25(31)23(18-22)28(36)34-26-13-9-14-27-24(26)20-33-35(27)17-8-7-12-21-10-5-4-6-11-21/h4-6,9-11,13-16,18,20H,7-8,12,17,19H2,1-3H3,(H,32,37)(H,34,36) |
| InChIKey | JHMWWWWWMBZHBG-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.07 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|