C14H9ClF3N5O2S — CID 168968650
3-N-(4-chlorophenyl)-1-(2,3,4-trifluorophenyl)sulfonyl-1,2,4-triazole-3,5-diamine (PubChem CID 168968650) has the molecular formula C14H9ClF3N5O2S and a molecular weight of 403.77 g/mol. Its IUPAC name is 3-N-(4-chlorophenyl)-1-(2,3,4-trifluorophenyl)sulfonyl-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(4-chlorophenyl)-1-(2,3,4-trifluorophenyl)sulfonyl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 168968650 |
| Molecular Formula | C14H9ClF3N5O2S |
| Molecular Weight | 403.77 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 3-N-(4-chlorophenyl)-1-(2,3,4-trifluorophenyl)sulfonyl-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2ccc(Cl)cc2)nn1S(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H9ClF3N5O2S/c15-7-1-3-8(4-2-7)20-14-21-13(19)23(22-14)26(24,25)10-6-5-9(16)11(17)12(10)18/h1-6H,(H3,19,20,21,22) |
| InChIKey | NSCBXHPOUIQLIP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.77 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|