C49H54O5 — CID 168968677
2-[[2-hydroxy-3-[[2-hydroxy-5-[[2-hydroxy-4-[(8Z,11Z)-pentadeca-8,11,14-trienyl]phenyl]methyl]phenyl]methyl]phenyl]methyl]-6-[(4-hydroxyphenyl)methyl]phenol (PubChem CID 168968677) has the molecular formula C49H54O5 and a molecular weight of 722.97 g/mol. Its IUPAC name is 2-[[2-hydroxy-3-[[2-hydroxy-5-[[2-hydroxy-4-[(8Z,11Z)-pentadeca-8,11,14-trienyl]phenyl]methyl]phenyl]methyl]phenyl]methyl]-6-[(4-hydroxyphenyl)methyl]phenol.
| Compound Name | 2-[[2-hydroxy-3-[[2-hydroxy-5-[[2-hydroxy-4-[(8Z,11Z)-pentadeca-8,11,14-trienyl]phenyl]methyl]phenyl]methyl]phenyl]methyl]-6-[(4-hydroxyphenyl)methyl]phenol |
|---|---|
| PubChem CID | 168968677 |
| Molecular Formula | C49H54O5 |
| Molecular Weight | 722.97 g/mol |
| Exact Mass | 722.40 |
| IUPAC Name | 2-[[2-hydroxy-3-[[2-hydroxy-5-[[2-hydroxy-4-[(8Z,11Z)-pentadeca-8,11,14-trienyl]phenyl]methyl]phenyl]methyl]phenyl]methyl]-6-[(4-hydroxyphenyl)methyl]phenol |
| SMILES | C=CC/C=C\C/C=C\CCCCCCCc1ccc(Cc2ccc(O)c(Cc3cccc(Cc4cccc(Cc5ccc(O)cc5)c4O)c3O)c2)c(O)c1 |
| InChI | InChI=1S/C49H54O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-36-22-26-39(47(52)33-36)31-38-25-29-46(51)44(32-38)35-43-21-16-20-42(49(43)54)34-41-19-15-18-40(48(41)53)30-37-23-27-45(50)28-24-37/h2,4-5,7-8,15-16,18-29,32-33,50-54H,1,3,6,9-14,17,30-31,34-35H2/b5-4-,8-7- |
| InChIKey | JKEFYQJEDLRACV-UTOQUPLUSA-N |
| XLogP | 11.54 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.97 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|