About fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate
fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate (PubChem CID 168968971) has the molecular formula C24H40FN3O3S
and a molecular weight of 469.67 g/mol. Its IUPAC name is fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 168968971 |
| Molecular Formula | C24H40FN3O3S |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate |
| SMILES | C=C(CCCC)N(CCCCCC)C(CC(NC(C)=O)c1nc(C(=O)OF)cs1)C(C)C |
| InChI | InChI=1S/C24H40FN3O3S/c1-7-9-11-12-14-28(18(5)13-10-8-2)22(17(3)4)15-20(26-19(6)29)23-27-21(16-32-23)24(30)31-25/h16-17,20,22H,5,7-15H2,1-4,6H3,(H,26,29) |
| InChIKey | KCZILOHLJFMGFP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate (CID 168968971) is fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate is C=C(CCCC)N(CCCCCC)C(CC(NC(C)=O)c1nc(C(=O)OF)cs1)C(C)C.
What is the InChIKey of fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate?
The InChIKey is KCZILOHLJFMGFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H40FN3O3S/c1-7-9-11-12-14-28(18(5)13-10-8-2)22(17(3)4)15-20(26-19(6)29)23-27-21(16-32-23)24(30)31-25/h16-17,20,22H,5,7-15H2,1-4,6H3,(H,26,29).
What are the key properties of fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate?
fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate has a molecular weight of 469.67 g/mol, XLogP of 6.36, 16 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 2-[1-acetamido-3-[hex-1-en-2-yl(hexyl)amino]-4-methylpentyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 168968971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).