C45H51N4O7SSe — CID 168969755
CID 168969755 (PubChem CID 168969755) has the molecular formula C45H51N4O7SSe and a molecular weight of 870.95 g/mol.
| Compound Name | CID 168969755 |
|---|---|
| PubChem CID | 168969755 |
| Molecular Formula | C45H51N4O7SSe |
| Molecular Weight | 870.95 g/mol |
| Exact Mass | 871.26 |
| IUPAC Name | — |
| SMILES | CN1CCOCC1.COc1cccc(CN(C(=O)c2cc(-c3cc(S(C)(=O)=O)ccc3C(=O)N3Cc4ccccc4C[C@H]3C)n(C)c2C)c2ccc(O[Se])cc2)c1C |
| InChI | InChI=1S/C40H40N3O6SSe.C5H11NO/c1-25-20-28-10-7-8-11-30(28)24-42(25)39(44)34-19-18-33(50(6,46)47)21-36(34)37-22-35(27(3)41(37)4)40(45)43(31-14-16-32(49-51)17-15-31)23-29-12-9-13-38(48-5)26(29)2;1-6-2-4-7-5-3-6/h7-19,21-22,25H,20,23-24H2,1-6H3;2-5H2,1H3/t25-;/m1./s1 |
| InChIKey | KCXUIYYGWXOQSI-VQIWEWKSSA-N |
| XLogP | 6.57 |
| TPSA | 110.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.95 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|