About CID 168969756
CID 168969756 (PubChem CID 168969756) has the molecular formula C40H40N3O6SSe
and a molecular weight of 769.80 g/mol.
Molecular Properties
| Compound Name | CID 168969756 |
| PubChem CID | 168969756 |
| Molecular Formula | C40H40N3O6SSe |
| Molecular Weight | 769.80 g/mol |
| Exact Mass | 770.18 |
| IUPAC Name | — |
| SMILES | COc1cccc(CN(C(=O)c2cc(-c3cc(S(C)(=O)=O)ccc3C(=O)N3Cc4ccccc4C[C@H]3C)n(C)c2C)c2ccc(O[Se])cc2)c1C |
| InChI | InChI=1S/C40H40N3O6SSe/c1-25-20-28-10-7-8-11-30(28)24-42(25)39(44)34-19-18-33(50(6,46)47)21-36(34)37-22-35(27(3)41(37)4)40(45)43(31-14-16-32(49-51)17-15-31)23-29-12-9-13-38(48-5)26(29)2/h7-19,21-22,25H,20,23-24H2,1-6H3/t25-/m1/s1 |
| InChIKey | BNEOBEUTKVEYQO-RUZDIDTESA-N |
| XLogP | 6.62 |
| TPSA | 98.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 769.80 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 168969756 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168969756?
The IUPAC name of CID 168969756 (CID 168969756) is not available.
What is the SMILES notation for CID 168969756?
The canonical SMILES for CID 168969756 is COc1cccc(CN(C(=O)c2cc(-c3cc(S(C)(=O)=O)ccc3C(=O)N3Cc4ccccc4C[C@H]3C)n(C)c2C)c2ccc(O[Se])cc2)c1C.
What is the InChIKey of CID 168969756?
The InChIKey is BNEOBEUTKVEYQO-RUZDIDTESA-N. The full InChI is InChI=1S/C40H40N3O6SSe/c1-25-20-28-10-7-8-11-30(28)24-42(25)39(44)34-19-18-33(50(6,46)47)21-36(34)37-22-35(27(3)41(37)4)40(45)43(31-14-16-32(49-51)17-15-31)23-29-12-9-13-38(48-5)26(29)2/h7-19,21-22,25H,20,23-24H2,1-6H3/t25-/m1/s1.
What are the key properties of CID 168969756?
CID 168969756 has a molecular weight of 769.80 g/mol, XLogP of 6.62, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168969756 is sourced from PubChem (CID 168969756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).