C17H32FN5O2 — CID 168971627
2-methylpropyl (6S)-6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate (PubChem CID 168971627) has the molecular formula C17H32FN5O2 and a molecular weight of 357.47 g/mol. Its IUPAC name is 2-methylpropyl (6S)-6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate.
| Compound Name | 2-methylpropyl (6S)-6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 168971627 |
| Molecular Formula | C17H32FN5O2 |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 2-methylpropyl (6S)-6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
| SMILES | CC(C)COC(=O)C1CC2C[C@@](F)(CC/C(N)=N/NN)CCC2CN1 |
| InChI | InChI=1S/C17H32FN5O2/c1-11(2)10-25-16(24)14-7-13-8-17(18,5-3-12(13)9-21-14)6-4-15(19)22-23-20/h11-14,21,23H,3-10,20H2,1-2H3,(H2,19,22)/t12?,13?,14?,17-/m0/s1 |
| InChIKey | LEORCRHMXQQXAC-DCKBQRAASA-N |
| XLogP | 1.19 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|