C22H31N3O2 — CID 168971846
tert-butyl 5-[2-(2-methylphenyl)pyrazol-3-yl]azocane-1-carboxylate (PubChem CID 168971846) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is tert-butyl 5-[2-(2-methylphenyl)pyrazol-3-yl]azocane-1-carboxylate.
| Compound Name | tert-butyl 5-[2-(2-methylphenyl)pyrazol-3-yl]azocane-1-carboxylate |
|---|---|
| PubChem CID | 168971846 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | tert-butyl 5-[2-(2-methylphenyl)pyrazol-3-yl]azocane-1-carboxylate |
| SMILES | Cc1ccccc1-n1nccc1C1CCCN(C(=O)OC(C)(C)C)CCC1 |
| InChI | InChI=1S/C22H31N3O2/c1-17-9-5-6-12-19(17)25-20(13-14-23-25)18-10-7-15-24(16-8-11-18)21(26)27-22(2,3)4/h5-6,9,12-14,18H,7-8,10-11,15-16H2,1-4H3 |
| InChIKey | YDFDNKCGQRBADM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |