About 5-methoxy-1,3-oxazinan-2-one
5-methoxy-1,3-oxazinan-2-one (PubChem CID 168972110) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is 5-methoxy-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 5-methoxy-1,3-oxazinan-2-one |
| PubChem CID | 168972110 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | 5-methoxy-1,3-oxazinan-2-one |
| SMILES | COC1CNC(=O)OC1 |
| InChI | InChI=1S/C5H9NO3/c1-8-4-2-6-5(7)9-3-4/h4H,2-3H2,1H3,(H,6,7) |
| InChIKey | TWOSSFWVWAKNGU-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,3-oxazinan-2-one?
The IUPAC name of 5-methoxy-1,3-oxazinan-2-one (CID 168972110) is 5-methoxy-1,3-oxazinan-2-one.
What is the SMILES notation for 5-methoxy-1,3-oxazinan-2-one?
The canonical SMILES for 5-methoxy-1,3-oxazinan-2-one is COC1CNC(=O)OC1.
What is the InChIKey of 5-methoxy-1,3-oxazinan-2-one?
The InChIKey is TWOSSFWVWAKNGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-8-4-2-6-5(7)9-3-4/h4H,2-3H2,1H3,(H,6,7).
What are the key properties of 5-methoxy-1,3-oxazinan-2-one?
5-methoxy-1,3-oxazinan-2-one has a molecular weight of 131.13 g/mol, XLogP of -0.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,3-oxazinan-2-one is sourced from PubChem (CID 168972110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).