C9H12FNO3 — CID 168972185
methyl (E,2Z)-5-(2-fluoroethylimino)-2-(hydroxymethylidene)pent-3-enoate (PubChem CID 168972185) has the molecular formula C9H12FNO3 and a molecular weight of 201.20 g/mol. Its IUPAC name is methyl (E,2Z)-5-(2-fluoroethylimino)-2-(hydroxymethylidene)pent-3-enoate.
| Compound Name | methyl (E,2Z)-5-(2-fluoroethylimino)-2-(hydroxymethylidene)pent-3-enoate |
|---|---|
| PubChem CID | 168972185 |
| Molecular Formula | C9H12FNO3 |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | methyl (E,2Z)-5-(2-fluoroethylimino)-2-(hydroxymethylidene)pent-3-enoate |
| SMILES | COC(=O)C(=C\O)/C=C/C=N/CCF |
| InChI | InChI=1S/C9H12FNO3/c1-14-9(13)8(7-12)3-2-5-11-6-4-10/h2-3,5,7,12H,4,6H2,1H3/b3-2+,8-7-,11-5+ |
| InChIKey | NHQBEYSUOFPTNW-LBEQBQMJSA-N |
| XLogP | 1.20 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|