C9H14FN — CID 168972303
N-[(1E)-2-fluorobuta-1,3-dienyl]pentan-2-imine (PubChem CID 168972303) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is N-[(1E)-2-fluorobuta-1,3-dienyl]pentan-2-imine.
| Compound Name | N-[(1E)-2-fluorobuta-1,3-dienyl]pentan-2-imine |
|---|---|
| PubChem CID | 168972303 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-[(1E)-2-fluorobuta-1,3-dienyl]pentan-2-imine |
| SMILES | C=C/C(F)=C\N=C(/C)CCC |
| InChI | InChI=1S/C9H14FN/c1-4-6-8(3)11-7-9(10)5-2/h5,7H,2,4,6H2,1,3H3/b9-7+,11-8+ |
| InChIKey | WPTKEMPUJZURAG-BIZFVBGRSA-N |
| XLogP | 3.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|