C11H13F6N — CID 168972490
(E)-1,1,1,5,5,5-hexafluoro-4-methyl-N-[(E)-pent-2-en-2-yl]pent-3-en-2-imine (PubChem CID 168972490) has the molecular formula C11H13F6N and a molecular weight of 273.22 g/mol. Its IUPAC name is (E)-1,1,1,5,5,5-hexafluoro-4-methyl-N-[(E)-pent-2-en-2-yl]pent-3-en-2-imine.
| Compound Name | (E)-1,1,1,5,5,5-hexafluoro-4-methyl-N-[(E)-pent-2-en-2-yl]pent-3-en-2-imine |
|---|---|
| PubChem CID | 168972490 |
| Molecular Formula | C11H13F6N |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (E)-1,1,1,5,5,5-hexafluoro-4-methyl-N-[(E)-pent-2-en-2-yl]pent-3-en-2-imine |
| SMILES | CC/C=C(C)/N=C(/C=C(\C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H13F6N/c1-4-5-8(3)18-9(11(15,16)17)6-7(2)10(12,13)14/h5-6H,4H2,1-3H3/b7-6+,8-5+,18-9- |
| InChIKey | WGUJLRRGFUPQLZ-IUBMQTHPSA-N |
| XLogP | 4.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|