C20H26F3N5O2 — CID 168973377
6-[2-(ethoxymethoxy)-4-(trifluoromethyl)phenyl]-5-methyl-N-[(3R)-1-methylpiperidin-3-yl]-1,2,4-triazin-3-amine (PubChem CID 168973377) has the molecular formula C20H26F3N5O2 and a molecular weight of 425.46 g/mol. Its IUPAC name is 6-[2-(ethoxymethoxy)-4-(trifluoromethyl)phenyl]-5-methyl-N-[(3R)-1-methylpiperidin-3-yl]-1,2,4-triazin-3-amine.
| Compound Name | 6-[2-(ethoxymethoxy)-4-(trifluoromethyl)phenyl]-5-methyl-N-[(3R)-1-methylpiperidin-3-yl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 168973377 |
| Molecular Formula | C20H26F3N5O2 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 6-[2-(ethoxymethoxy)-4-(trifluoromethyl)phenyl]-5-methyl-N-[(3R)-1-methylpiperidin-3-yl]-1,2,4-triazin-3-amine |
| SMILES | CCOCOc1cc(C(F)(F)F)ccc1-c1nnc(N[C@@H]2CCCN(C)C2)nc1C |
| InChI | InChI=1S/C20H26F3N5O2/c1-4-29-12-30-17-10-14(20(21,22)23)7-8-16(17)18-13(2)24-19(27-26-18)25-15-6-5-9-28(3)11-15/h7-8,10,15H,4-6,9,11-12H2,1-3H3,(H,24,25,27)/t15-/m1/s1 |
| InChIKey | FJKKCAICODEXHR-OAHLLOKOSA-N |
| XLogP | 3.74 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|