C20H29N7O2S — CID 168974210
3-[amino-[(Z)-1-aminoethylideneamino]amino]-N-[3-[(5-tert-butyl-4-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]benzamide (PubChem CID 168974210) has the molecular formula C20H29N7O2S and a molecular weight of 431.57 g/mol. Its IUPAC name is 3-[amino-[(Z)-1-aminoethylideneamino]amino]-N-[3-[(5-tert-butyl-4-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]benzamide.
| Compound Name | 3-[amino-[(Z)-1-aminoethylideneamino]amino]-N-[3-[(5-tert-butyl-4-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 168974210 |
| Molecular Formula | C20H29N7O2S |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 3-[amino-[(Z)-1-aminoethylideneamino]amino]-N-[3-[(5-tert-butyl-4-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]benzamide |
| SMILES | C/C(N)=N/N(N)c1cccc(C(=O)NCCC(=O)Nc2nc(C)c(C(C)(C)C)s2)c1 |
| InChI | InChI=1S/C20H29N7O2S/c1-12-17(20(3,4)5)30-19(24-12)25-16(28)9-10-23-18(29)14-7-6-8-15(11-14)27(22)26-13(2)21/h6-8,11H,9-10,22H2,1-5H3,(H2,21,26)(H,23,29)(H,24,25,28) |
| InChIKey | RVFHKZLIEQFURO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 138.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|