C29H33F2N7O4S — CID 168974575
(3,3-difluorocyclopentyl) 4-methyl-2-[[(3S)-6-(methylamino)-3-[[7-(5-methyl-1,2,4-oxadiazol-3-yl)isoquinolin-1-yl]amino]hexanoyl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 168974575) has the molecular formula C29H33F2N7O4S and a molecular weight of 613.69 g/mol. Its IUPAC name is (3,3-difluorocyclopentyl) 4-methyl-2-[[(3S)-6-(methylamino)-3-[[7-(5-methyl-1,2,4-oxadiazol-3-yl)isoquinolin-1-yl]amino]hexanoyl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | (3,3-difluorocyclopentyl) 4-methyl-2-[[(3S)-6-(methylamino)-3-[[7-(5-methyl-1,2,4-oxadiazol-3-yl)isoquinolin-1-yl]amino]hexanoyl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 168974575 |
| Molecular Formula | C29H33F2N7O4S |
| Molecular Weight | 613.69 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | (3,3-difluorocyclopentyl) 4-methyl-2-[[(3S)-6-(methylamino)-3-[[7-(5-methyl-1,2,4-oxadiazol-3-yl)isoquinolin-1-yl]amino]hexanoyl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | CNCCC[C@@H](CC(=O)Nc1nc(C)c(C(=O)OC2CCC(F)(F)C2)s1)Nc1nccc2ccc(-c3noc(C)n3)cc12 |
| InChI | InChI=1S/C29H33F2N7O4S/c1-16-24(27(40)41-21-8-10-29(30,31)15-21)43-28(34-16)37-23(39)14-20(5-4-11-32-3)36-26-22-13-19(25-35-17(2)42-38-25)7-6-18(22)9-12-33-26/h6-7,9,12-13,20-21,32H,4-5,8,10-11,14-15H2,1-3H3,(H,33,36)(H,34,37,39)/t20-,21?/m0/s1 |
| InChIKey | SVWMWZKXJUEVPS-BGERDNNASA-N |
| XLogP | 5.51 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.69 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|