C22H22F4N4O3S — CID 168974794
1-[3-(7-fluoro-1-benzofuran-5-yl)-6-(2,2,2-trifluoroethoxymethyl)pyrazin-2-yl]-N-methylsulfanylpiperidine-4-carboxamide (PubChem CID 168974794) has the molecular formula C22H22F4N4O3S and a molecular weight of 498.50 g/mol. Its IUPAC name is 1-[3-(7-fluoro-1-benzofuran-5-yl)-6-(2,2,2-trifluoroethoxymethyl)pyrazin-2-yl]-N-methylsulfanylpiperidine-4-carboxamide.
| Compound Name | 1-[3-(7-fluoro-1-benzofuran-5-yl)-6-(2,2,2-trifluoroethoxymethyl)pyrazin-2-yl]-N-methylsulfanylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 168974794 |
| Molecular Formula | C22H22F4N4O3S |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 1-[3-(7-fluoro-1-benzofuran-5-yl)-6-(2,2,2-trifluoroethoxymethyl)pyrazin-2-yl]-N-methylsulfanylpiperidine-4-carboxamide |
| SMILES | CSNC(=O)C1CCN(c2nc(COCC(F)(F)F)cnc2-c2cc(F)c3occc3c2)CC1 |
| InChI | InChI=1S/C22H22F4N4O3S/c1-34-29-21(31)13-2-5-30(6-3-13)20-18(15-8-14-4-7-33-19(14)17(23)9-15)27-10-16(28-20)11-32-12-22(24,25)26/h4,7-10,13H,2-3,5-6,11-12H2,1H3,(H,29,31) |
| InChIKey | ZUIWZHWMSDJMKK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|