C23H26FN3O4 — CID 168974798
(2S,4S)-1-[3-(7-fluoro-1-benzofuran-5-yl)-6-(3-methoxypropyl)pyrazin-2-yl]-2-methylpiperidine-4-carboxylic acid (PubChem CID 168974798) has the molecular formula C23H26FN3O4 and a molecular weight of 427.48 g/mol. Its IUPAC name is (2S,4S)-1-[3-(7-fluoro-1-benzofuran-5-yl)-6-(3-methoxypropyl)pyrazin-2-yl]-2-methylpiperidine-4-carboxylic acid.
| Compound Name | (2S,4S)-1-[3-(7-fluoro-1-benzofuran-5-yl)-6-(3-methoxypropyl)pyrazin-2-yl]-2-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 168974798 |
| Molecular Formula | C23H26FN3O4 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (2S,4S)-1-[3-(7-fluoro-1-benzofuran-5-yl)-6-(3-methoxypropyl)pyrazin-2-yl]-2-methylpiperidine-4-carboxylic acid |
| SMILES | COCCCc1cnc(-c2cc(F)c3occc3c2)c(N2CC[C@H](C(=O)O)C[C@@H]2C)n1 |
| InChI | InChI=1S/C23H26FN3O4/c1-14-10-16(23(28)29)5-7-27(14)22-20(25-13-18(26-22)4-3-8-30-2)17-11-15-6-9-31-21(15)19(24)12-17/h6,9,11-14,16H,3-5,7-8,10H2,1-2H3,(H,28,29)/t14-,16-/m0/s1 |
| InChIKey | DSFWKFCZMSTWFZ-HOCLYGCPSA-N |
| XLogP | 4.30 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|