About 1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid
1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid (PubChem CID 168974819) has the molecular formula C21H24N2O6
and a molecular weight of 400.43 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid |
| PubChem CID | 168974819 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid |
| SMILES | COCCCc1cnc(-c2ccc3c(c2)OCO3)c(N2CC(OC)(C(=O)O)C2)c1 |
| InChI | InChI=1S/C21H24N2O6/c1-26-7-3-4-14-8-16(23-11-21(12-23,27-2)20(24)25)19(22-10-14)15-5-6-17-18(9-15)29-13-28-17/h5-6,8-10H,3-4,7,11-13H2,1-2H3,(H,24,25) |
| InChIKey | XNORQYBUPWWQDP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid?
The IUPAC name of 1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid (CID 168974819) is 1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid.
What is the SMILES notation for 1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid?
The canonical SMILES for 1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid is COCCCc1cnc(-c2ccc3c(c2)OCO3)c(N2CC(OC)(C(=O)O)C2)c1.
What is the InChIKey of 1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid?
The InChIKey is XNORQYBUPWWQDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O6/c1-26-7-3-4-14-8-16(23-11-21(12-23,27-2)20(24)25)19(22-10-14)15-5-6-17-18(9-15)29-13-28-17/h5-6,8-10H,3-4,7,11-13H2,1-2H3,(H,24,25).
What are the key properties of 1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid?
1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid has a molecular weight of 400.43 g/mol, XLogP of 2.35, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,3-benzodioxol-5-yl)-5-(3-methoxypropyl)-3-pyridinyl]-3-methoxyazetidine-3-carboxylic acid is sourced from PubChem (CID 168974819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).