About ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate
ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate (PubChem CID 168974913) has the molecular formula C15H18ClF3IN3O2
and a molecular weight of 491.68 g/mol. Its IUPAC name is ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate |
| PubChem CID | 168974913 |
| Molecular Formula | C15H18ClF3IN3O2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2nc(CCC(F)(F)F)c(Cl)nc2I)CC1 |
| InChI | InChI=1S/C15H18ClF3IN3O2/c1-2-25-14(24)9-4-7-23(8-5-9)13-12(20)22-11(16)10(21-13)3-6-15(17,18)19/h9H,2-8H2,1H3 |
| InChIKey | JHFPUKQKDRXNFD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate (CID 168974913) is ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate is CCOC(=O)C1CCN(c2nc(CCC(F)(F)F)c(Cl)nc2I)CC1.
What is the InChIKey of ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate?
The InChIKey is JHFPUKQKDRXNFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClF3IN3O2/c1-2-25-14(24)9-4-7-23(8-5-9)13-12(20)22-11(16)10(21-13)3-6-15(17,18)19/h9H,2-8H2,1H3.
What are the key properties of ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate?
ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate has a molecular weight of 491.68 g/mol, XLogP of 4.01, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[5-chloro-3-iodo-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylate is sourced from PubChem (CID 168974913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).