C22H27F3N4O3 — CID 168975186
1-[3-[4-(2-methoxyethylamino)phenyl]-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylic acid (PubChem CID 168975186) has the molecular formula C22H27F3N4O3 and a molecular weight of 452.48 g/mol. Its IUPAC name is 1-[3-[4-(2-methoxyethylamino)phenyl]-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[4-(2-methoxyethylamino)phenyl]-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 168975186 |
| Molecular Formula | C22H27F3N4O3 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 1-[3-[4-(2-methoxyethylamino)phenyl]-6-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperidine-4-carboxylic acid |
| SMILES | COCCNc1ccc(-c2ncc(CCC(F)(F)F)nc2N2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C22H27F3N4O3/c1-32-13-10-26-17-4-2-15(3-5-17)19-20(29-11-7-16(8-12-29)21(30)31)28-18(14-27-19)6-9-22(23,24)25/h2-5,14,16,26H,6-13H2,1H3,(H,30,31) |
| InChIKey | UPRLLOOAIPZMRO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|