C17H21ClN4O2S — CID 16897605
2-[(4-chlorophenyl)carbamoylamino]-4-methyl-N-pentyl-1,3-thiazole-5-carboxamide (PubChem CID 16897605) has the molecular formula C17H21ClN4O2S and a molecular weight of 380.90 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoylamino]-4-methyl-N-pentyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(4-chlorophenyl)carbamoylamino]-4-methyl-N-pentyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 16897605 |
| Molecular Formula | C17H21ClN4O2S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoylamino]-4-methyl-N-pentyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCCCNC(=O)c1sc(NC(=O)Nc2ccc(Cl)cc2)nc1C |
| InChI | InChI=1S/C17H21ClN4O2S/c1-3-4-5-10-19-15(23)14-11(2)20-17(25-14)22-16(24)21-13-8-6-12(18)7-9-13/h6-9H,3-5,10H2,1-2H3,(H,19,23)(H2,20,21,22,24) |
| InChIKey | VYOVJIPXHIXBIY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|