About disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate
disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate (PubChem CID 168976867) has the molecular formula C12H8INNa2O4
and a molecular weight of 403.08 g/mol. Its IUPAC name is disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate.
Molecular Properties
| Compound Name | disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate |
| PubChem CID | 168976867 |
| Molecular Formula | C12H8INNa2O4 |
| Molecular Weight | 403.08 g/mol |
| Exact Mass | 402.93 |
| IUPAC Name | disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate |
| SMILES | COC(=O)c1c([O-])nc2c(C)cc(I)cc2c1[O-].[Na+].[Na+] |
| InChI | InChI=1S/C12H10INO4.2Na/c1-5-3-6(13)4-7-9(5)14-11(16)8(10(7)15)12(17)18-2;;/h3-4H,1-2H3,(H2,14,15,16);;/q;2*+1/p-2 |
| InChIKey | AWNPEVXLJOOCNO-UHFFFAOYSA-L |
| XLogP | -4.91 |
| TPSA | 85.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.08 |
| LogP ≤ 5 | -4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate?
The IUPAC name of disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate (CID 168976867) is disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate.
What is the SMILES notation for disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate?
The canonical SMILES for disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate is COC(=O)c1c([O-])nc2c(C)cc(I)cc2c1[O-].[Na+].[Na+].
What is the InChIKey of disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate?
The InChIKey is AWNPEVXLJOOCNO-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H10INO4.2Na/c1-5-3-6(13)4-7-9(5)14-11(16)8(10(7)15)12(17)18-2;;/h3-4H,1-2H3,(H2,14,15,16);;/q;2*+1/p-2.
What are the key properties of disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate?
disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate has a molecular weight of 403.08 g/mol, XLogP of -4.91, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;6-iodo-3-methoxycarbonyl-8-methylquinoline-2,4-diolate is sourced from PubChem (CID 168976867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).