About 1,7-diazaspiro[3.5]nonane;ethane
1,7-diazaspiro[3.5]nonane;ethane (PubChem CID 168977317) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 1,7-diazaspiro[3.5]nonane;ethane.
Molecular Properties
| Compound Name | 1,7-diazaspiro[3.5]nonane;ethane |
| PubChem CID | 168977317 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 1,7-diazaspiro[3.5]nonane;ethane |
| SMILES | C1CC2(CCN1)CCN2.CC |
| InChI | InChI=1S/C7H14N2.C2H6/c1-4-8-5-2-7(1)3-6-9-7;1-2/h8-9H,1-6H2;1-2H3 |
| InChIKey | MLZNPROCUZWKHK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,7-diazaspiro[3.5]nonane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-diazaspiro[3.5]nonane;ethane?
The IUPAC name of 1,7-diazaspiro[3.5]nonane;ethane (CID 168977317) is 1,7-diazaspiro[3.5]nonane;ethane.
What is the SMILES notation for 1,7-diazaspiro[3.5]nonane;ethane?
The canonical SMILES for 1,7-diazaspiro[3.5]nonane;ethane is C1CC2(CCN1)CCN2.CC.
What is the InChIKey of 1,7-diazaspiro[3.5]nonane;ethane?
The InChIKey is MLZNPROCUZWKHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.C2H6/c1-4-8-5-2-7(1)3-6-9-7;1-2/h8-9H,1-6H2;1-2H3.
What are the key properties of 1,7-diazaspiro[3.5]nonane;ethane?
1,7-diazaspiro[3.5]nonane;ethane has a molecular weight of 156.27 g/mol, XLogP of 1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-diazaspiro[3.5]nonane;ethane is sourced from PubChem (CID 168977317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).