C11H24N2 — CID 168977388
ethane;2-methyl-1,3,4,4a,5,6,7,8-octahydropyrido[1,2-c]pyrimidine (PubChem CID 168977388) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is ethane;2-methyl-1,3,4,4a,5,6,7,8-octahydropyrido[1,2-c]pyrimidine.
| Compound Name | ethane;2-methyl-1,3,4,4a,5,6,7,8-octahydropyrido[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 168977388 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | ethane;2-methyl-1,3,4,4a,5,6,7,8-octahydropyrido[1,2-c]pyrimidine |
| SMILES | CC.CN1CCC2CCCCN2C1 |
| InChI | InChI=1S/C9H18N2.C2H6/c1-10-7-5-9-4-2-3-6-11(9)8-10;1-2/h9H,2-8H2,1H3;1-2H3 |
| InChIKey | KIFUSHCMQBRGFT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |