About sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane
sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane (PubChem CID 168977871) has the molecular formula C6H12F3N2Na
and a molecular weight of 192.16 g/mol. Its IUPAC name is sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane.
Molecular Properties
| Compound Name | sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane |
| PubChem CID | 168977871 |
| Molecular Formula | C6H12F3N2Na |
| Molecular Weight | 192.16 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane |
| SMILES | NN1CCCC1.[CH2-]C(F)(F)F.[Na+] |
| InChI | InChI=1S/C4H10N2.C2H2F3.Na/c5-6-3-1-2-4-6;1-2(3,4)5;/h1-5H2;1H2;/q;-1;+1 |
| InChIKey | IWLLBXUVJLVKSV-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.16 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane?
The IUPAC name of sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane (CID 168977871) is sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane.
What is the SMILES notation for sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane?
The canonical SMILES for sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane is NN1CCCC1.[CH2-]C(F)(F)F.[Na+].
What is the InChIKey of sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane?
The InChIKey is IWLLBXUVJLVKSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2.C2H2F3.Na/c5-6-3-1-2-4-6;1-2(3,4)5;/h1-5H2;1H2;/q;-1;+1.
What are the key properties of sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane?
sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane has a molecular weight of 192.16 g/mol, XLogP of -1.66, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;pyrrolidin-1-amine;1,1,1-trifluoroethane is sourced from PubChem (CID 168977871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).