About 4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol
4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol (PubChem CID 168978633) has the molecular formula C23H24FN5O
and a molecular weight of 405.48 g/mol. Its IUPAC name is 4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol.
Molecular Properties
| Compound Name | 4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol |
| PubChem CID | 168978633 |
| Molecular Formula | C23H24FN5O |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol |
| SMILES | C1CCC2(CC2)NC1.Cn1cc2cc(-c3cnc4ccccc4n3)c(O)c(F)c2n1 |
| InChI | InChI=1S/C16H11FN4O.C7H13N/c1-21-8-9-6-10(16(22)14(17)15(9)20-21)13-7-18-11-4-2-3-5-12(11)19-13;1-2-6-8-7(3-1)4-5-7/h2-8,22H,1H3;8H,1-6H2 |
| InChIKey | YLBJQLMLASPKBV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol?
The IUPAC name of 4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol (CID 168978633) is 4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol.
What is the SMILES notation for 4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol?
The canonical SMILES for 4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol is C1CCC2(CC2)NC1.Cn1cc2cc(-c3cnc4ccccc4n3)c(O)c(F)c2n1.
What is the InChIKey of 4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol?
The InChIKey is YLBJQLMLASPKBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11FN4O.C7H13N/c1-21-8-9-6-10(16(22)14(17)15(9)20-21)13-7-18-11-4-2-3-5-12(11)19-13;1-2-6-8-7(3-1)4-5-7/h2-8,22H,1H3;8H,1-6H2.
What are the key properties of 4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol?
4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol has a molecular weight of 405.48 g/mol, XLogP of 4.32, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azaspiro[2.5]octane;7-fluoro-2-methyl-5-quinoxalin-2-ylindazol-6-ol is sourced from PubChem (CID 168978633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).