C23H26N5NaO — CID 168978795
sodium;2,7-dimethyl-5-(6-pyrrolidin-1-yl-1,8-naphthyridin-2-yl)indazol-6-ol;ethane (PubChem CID 168978795) has the molecular formula C23H26N5NaO and a molecular weight of 411.49 g/mol. Its IUPAC name is sodium;2,7-dimethyl-5-(6-pyrrolidin-1-yl-1,8-naphthyridin-2-yl)indazol-6-ol;ethane.
| Compound Name | sodium;2,7-dimethyl-5-(6-pyrrolidin-1-yl-1,8-naphthyridin-2-yl)indazol-6-ol;ethane |
|---|---|
| PubChem CID | 168978795 |
| Molecular Formula | C23H26N5NaO |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | sodium;2,7-dimethyl-5-(6-pyrrolidin-1-yl-1,8-naphthyridin-2-yl)indazol-6-ol;ethane |
| SMILES | Cc1c(O)c(-c2ccc3cc(N4CCCC4)cnc3n2)cc2cn(C)nc12.[CH2-]C.[Na+] |
| InChI | InChI=1S/C21H21N5O.C2H5.Na/c1-13-19-15(12-25(2)24-19)10-17(20(13)27)18-6-5-14-9-16(11-22-21(14)23-18)26-7-3-4-8-26;1-2;/h5-6,9-12,27H,3-4,7-8H2,1-2H3;1H2,2H3;/q;-1;+1 |
| InChIKey | CXZMZHFLFVUZGF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|